C27H33N3O2S — CID 1141207
3-cyclohexyl-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]thiourea (PubChem CID 1141207) has the molecular formula C27H33N3O2S and a molecular weight of 463.65 g/mol. Its IUPAC name is 3-cyclohexyl-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]thiourea.
| Compound Name | 3-cyclohexyl-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 1141207 |
| Molecular Formula | C27H33N3O2S |
| Molecular Weight | 463.65 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | 3-cyclohexyl-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CN(Cc2cc3c(C)cc(C)cc3[nH]c2=O)C(=S)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C27H33N3O2S/c1-18-13-19(2)24-15-21(26(31)29-25(24)14-18)17-30(16-20-9-11-23(32-3)12-10-20)27(33)28-22-7-5-4-6-8-22/h9-15,22H,4-8,16-17H2,1-3H3,(H,28,33)(H,29,31) |
| InChIKey | CMFFNAGTKIOUFO-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.65 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|