C26H31N3OS — CID 3169358
1-benzyl-3-cyclohexyl-1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea (PubChem CID 3169358) has the molecular formula C26H31N3OS and a molecular weight of 433.62 g/mol. Its IUPAC name is 1-benzyl-3-cyclohexyl-1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea.
| Compound Name | 1-benzyl-3-cyclohexyl-1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 3169358 |
| Molecular Formula | C26H31N3OS |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 1-benzyl-3-cyclohexyl-1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
| SMILES | Cc1ccc(C)c2[nH]c(=O)c(CN(Cc3ccccc3)C(=S)NC3CCCCC3)cc12 |
| InChI | InChI=1S/C26H31N3OS/c1-18-13-14-19(2)24-23(18)15-21(25(30)28-24)17-29(16-20-9-5-3-6-10-20)26(31)27-22-11-7-4-8-12-22/h3,5-6,9-10,13-15,22H,4,7-8,11-12,16-17H2,1-2H3,(H,27,31)(H,28,30) |
| InChIKey | RKENRMOLSXOOOY-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|