C25H25N3O2S — CID 1140405
1-benzyl-1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(furan-2-ylmethyl)thiourea (PubChem CID 1140405) has the molecular formula C25H25N3O2S and a molecular weight of 431.56 g/mol. Its IUPAC name is 1-benzyl-1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-benzyl-1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 1140405 |
| Molecular Formula | C25H25N3O2S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 1-benzyl-1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(furan-2-ylmethyl)thiourea |
| SMILES | Cc1ccc(C)c2[nH]c(=O)c(CN(Cc3ccccc3)C(=S)NCc3ccco3)cc12 |
| InChI | InChI=1S/C25H25N3O2S/c1-17-10-11-18(2)23-22(17)13-20(24(29)27-23)16-28(15-19-7-4-3-5-8-19)25(31)26-14-21-9-6-12-30-21/h3-13H,14-16H2,1-2H3,(H,26,31)(H,27,29) |
| InChIKey | ISYLSDQVSYYTGJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_urea_N(1)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|