C23H23N3O3S — CID 1157186
1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1,3-bis(furan-2-ylmethyl)thiourea (PubChem CID 1157186) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is 1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1,3-bis(furan-2-ylmethyl)thiourea.
| Compound Name | 1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1,3-bis(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 1157186 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1,3-bis(furan-2-ylmethyl)thiourea |
| SMILES | Cc1cc(C)c2cc(CN(Cc3ccco3)C(=S)NCc3ccco3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C23H23N3O3S/c1-15-9-16(2)20-11-17(22(27)25-21(20)10-15)13-26(14-19-6-4-8-29-19)23(30)24-12-18-5-3-7-28-18/h3-11H,12-14H2,1-2H3,(H,24,30)(H,25,27) |
| InChIKey | KOIACENXBYPJNH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|