C25H25N3O2S — CID 1141828
3-(2,4-dimethylphenyl)-1-(furan-2-ylmethyl)-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea (PubChem CID 1141828) has the molecular formula C25H25N3O2S and a molecular weight of 431.56 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-1-(furan-2-ylmethyl)-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea.
| Compound Name | 3-(2,4-dimethylphenyl)-1-(furan-2-ylmethyl)-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 1141828 |
| Molecular Formula | C25H25N3O2S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-1-(furan-2-ylmethyl)-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
| SMILES | Cc1ccc(NC(=S)N(Cc2ccco2)Cc2cc3cc(C)ccc3[nH]c2=O)c(C)c1 |
| InChI | InChI=1S/C25H25N3O2S/c1-16-6-8-22(18(3)11-16)27-25(31)28(15-21-5-4-10-30-21)14-20-13-19-12-17(2)7-9-23(19)26-24(20)29/h4-13H,14-15H2,1-3H3,(H,26,29)(H,27,31) |
| InChIKey | SLLVGMPCOORDPX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|