C24H29N3O2S — CID 3174131
3-(2,4-dimethylphenyl)-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-hydroxypropyl)thiourea (PubChem CID 3174131) has the molecular formula C24H29N3O2S and a molecular weight of 423.58 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-hydroxypropyl)thiourea.
| Compound Name | 3-(2,4-dimethylphenyl)-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-hydroxypropyl)thiourea |
|---|---|
| PubChem CID | 3174131 |
| Molecular Formula | C24H29N3O2S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-hydroxypropyl)thiourea |
| SMILES | CCc1ccc2[nH]c(=O)c(CN(CCCO)C(=S)Nc3ccc(C)cc3C)cc2c1 |
| InChI | InChI=1S/C24H29N3O2S/c1-4-18-7-9-22-19(13-18)14-20(23(29)25-22)15-27(10-5-11-28)24(30)26-21-8-6-16(2)12-17(21)3/h6-9,12-14,28H,4-5,10-11,15H2,1-3H3,(H,25,29)(H,26,30) |
| InChIKey | SNSUBKKSXGXYGH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|