C23H27N3O2S — CID 1141860
1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2,4-dimethylphenyl)-1-(2-hydroxyethyl)thiourea (PubChem CID 1141860) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is 1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2,4-dimethylphenyl)-1-(2-hydroxyethyl)thiourea.
| Compound Name | 1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2,4-dimethylphenyl)-1-(2-hydroxyethyl)thiourea |
|---|---|
| PubChem CID | 1141860 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2,4-dimethylphenyl)-1-(2-hydroxyethyl)thiourea |
| SMILES | Cc1ccc(NC(=S)N(CCO)Cc2cc3c(C)ccc(C)c3[nH]c2=O)c(C)c1 |
| InChI | InChI=1S/C23H27N3O2S/c1-14-5-8-20(17(4)11-14)24-23(29)26(9-10-27)13-18-12-19-15(2)6-7-16(3)21(19)25-22(18)28/h5-8,11-12,27H,9-10,13H2,1-4H3,(H,24,29)(H,25,28) |
| InChIKey | LGMMGIOHOMKJAZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|