C28H36N4O2S — CID 1141887
1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2,4-dimethylphenyl)-1-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 1141887) has the molecular formula C28H36N4O2S and a molecular weight of 492.69 g/mol. Its IUPAC name is 1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2,4-dimethylphenyl)-1-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2,4-dimethylphenyl)-1-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 1141887 |
| Molecular Formula | C28H36N4O2S |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | 1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2,4-dimethylphenyl)-1-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | Cc1ccc(NC(=S)N(CCCN2CCOCC2)Cc2cc3cc(C)cc(C)c3[nH]c2=O)c(C)c1 |
| InChI | InChI=1S/C28H36N4O2S/c1-19-6-7-25(21(3)14-19)29-28(35)32(9-5-8-31-10-12-34-13-11-31)18-24-17-23-16-20(2)15-22(4)26(23)30-27(24)33/h6-7,14-17H,5,8-13,18H2,1-4H3,(H,29,35)(H,30,33) |
| InChIKey | HBQGPWRBSOEDBR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|