C26H32N4O2S — CID 1141870
3-(2,4-dimethylphenyl)-1-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)thiourea (PubChem CID 1141870) has the molecular formula C26H32N4O2S and a molecular weight of 464.64 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-1-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 3-(2,4-dimethylphenyl)-1-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 1141870 |
| Molecular Formula | C26H32N4O2S |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-1-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)thiourea |
| SMILES | Cc1ccc(NC(=S)N(CCN2CCOCC2)Cc2cc3cccc(C)c3[nH]c2=O)c(C)c1 |
| InChI | InChI=1S/C26H32N4O2S/c1-18-7-8-23(20(3)15-18)27-26(33)30(10-9-29-11-13-32-14-12-29)17-22-16-21-6-4-5-19(2)24(21)28-25(22)31/h4-8,15-16H,9-14,17H2,1-3H3,(H,27,33)(H,28,31) |
| InChIKey | FSNDAZVUEDRZBK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|