C26H30N4O4S — CID 1142009
methyl 2-[[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl-(2-morpholin-4-ylethyl)carbamothioyl]amino]benzoate (PubChem CID 1142009) has the molecular formula C26H30N4O4S and a molecular weight of 494.62 g/mol. Its IUPAC name is methyl 2-[[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl-(2-morpholin-4-ylethyl)carbamothioyl]amino]benzoate.
| Compound Name | methyl 2-[[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl-(2-morpholin-4-ylethyl)carbamothioyl]amino]benzoate |
|---|---|
| PubChem CID | 1142009 |
| Molecular Formula | C26H30N4O4S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | methyl 2-[[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl-(2-morpholin-4-ylethyl)carbamothioyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=S)N(CCN1CCOCC1)Cc1cc2ccc(C)cc2[nH]c1=O |
| InChI | InChI=1S/C26H30N4O4S/c1-18-7-8-19-16-20(24(31)27-23(19)15-18)17-30(10-9-29-11-13-34-14-12-29)26(35)28-22-6-4-3-5-21(22)25(32)33-2/h3-8,15-16H,9-14,17H2,1-2H3,(H,27,31)(H,28,35) |
| InChIKey | IIVXRMWCMDAOTF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|