C26H32N4O3S — CID 1140425
3-(4-ethoxyphenyl)-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)thiourea (PubChem CID 1140425) has the molecular formula C26H32N4O3S and a molecular weight of 480.63 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 3-(4-ethoxyphenyl)-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 1140425 |
| Molecular Formula | C26H32N4O3S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 3-(4-ethoxyphenyl)-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)N(CCN2CCOCC2)Cc2cc3cc(C)ccc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C26H32N4O3S/c1-3-33-23-7-5-22(6-8-23)27-26(34)30(11-10-29-12-14-32-15-13-29)18-21-17-20-16-19(2)4-9-24(20)28-25(21)31/h4-9,16-17H,3,10-15,18H2,1-2H3,(H,27,34)(H,28,31) |
| InChIKey | CJJIDIKSOAECQP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 69.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|