C24H27ClN4O3S — CID 1137810
3-(3-chlorophenyl)-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)thiourea (PubChem CID 1137810) has the molecular formula C24H27ClN4O3S and a molecular weight of 487.03 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 3-(3-chlorophenyl)-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 1137810 |
| Molecular Formula | C24H27ClN4O3S |
| Molecular Weight | 487.03 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)thiourea |
| SMILES | COc1ccc2[nH]c(=O)c(CN(CCN3CCOCC3)C(=S)Nc3cccc(Cl)c3)cc2c1 |
| InChI | InChI=1S/C24H27ClN4O3S/c1-31-21-5-6-22-17(14-21)13-18(23(30)27-22)16-29(8-7-28-9-11-32-12-10-28)24(33)26-20-4-2-3-19(25)15-20/h2-6,13-15H,7-12,16H2,1H3,(H,26,33)(H,27,30) |
| InChIKey | VFROVXHQAPJEAA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 69.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.03 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|