C17H23N3O2S — CID 3171087
1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-ethyl-1-(2-hydroxyethyl)thiourea (PubChem CID 3171087) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is 1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-ethyl-1-(2-hydroxyethyl)thiourea.
| Compound Name | 1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-ethyl-1-(2-hydroxyethyl)thiourea |
|---|---|
| PubChem CID | 3171087 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-ethyl-1-(2-hydroxyethyl)thiourea |
| SMILES | CCNC(=S)N(CCO)Cc1cc2ccc(C)c(C)c2[nH]c1=O |
| InChI | InChI=1S/C17H23N3O2S/c1-4-18-17(23)20(7-8-21)10-14-9-13-6-5-11(2)12(3)15(13)19-16(14)22/h5-6,9,21H,4,7-8,10H2,1-3H3,(H,18,23)(H,19,22) |
| InChIKey | CNJMVGCTOFQHNB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|