C23H37N4OS+ — CID 7108902
2-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl-(2-methylpropylcarbamothioyl)amino]ethyl-diethylazanium (PubChem CID 7108902) has the molecular formula C23H37N4OS+ and a molecular weight of 417.64 g/mol. Its IUPAC name is 2-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl-(2-methylpropylcarbamothioyl)amino]ethyl-diethylazanium.
| Compound Name | 2-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl-(2-methylpropylcarbamothioyl)amino]ethyl-diethylazanium |
|---|---|
| PubChem CID | 7108902 |
| Molecular Formula | C23H37N4OS+ |
| Molecular Weight | 417.64 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | 2-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl-(2-methylpropylcarbamothioyl)amino]ethyl-diethylazanium |
| SMILES | CC[NH+](CC)CCN(Cc1cc2ccc(C)c(C)c2[nH]c1=O)C(=S)NCC(C)C |
| InChI | InChI=1S/C23H36N4OS/c1-7-26(8-2)11-12-27(23(29)24-14-16(3)4)15-20-13-19-10-9-17(5)18(6)21(19)25-22(20)28/h9-10,13,16H,7-8,11-12,14-15H2,1-6H3,(H,24,29)(H,25,28)/p+1 |
| InChIKey | MELUYKPFLOLDHA-UHFFFAOYSA-O |
| XLogP | 2.40 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.64 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|