C25H32N4OS — CID 3172510
1-[2-(dimethylamino)ethyl]-1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(1-phenylethyl)thiourea (PubChem CID 3172510) has the molecular formula C25H32N4OS and a molecular weight of 436.63 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(1-phenylethyl)thiourea.
| Compound Name | 1-[2-(dimethylamino)ethyl]-1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(1-phenylethyl)thiourea |
|---|---|
| PubChem CID | 3172510 |
| Molecular Formula | C25H32N4OS |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(1-phenylethyl)thiourea |
| SMILES | Cc1ccc2cc(CN(CCN(C)C)C(=S)NC(C)c3ccccc3)c(=O)[nH]c2c1C |
| InChI | InChI=1S/C25H32N4OS/c1-17-11-12-21-15-22(24(30)27-23(21)18(17)2)16-29(14-13-28(4)5)25(31)26-19(3)20-9-7-6-8-10-20/h6-12,15,19H,13-14,16H2,1-5H3,(H,26,31)(H,27,30) |
| InChIKey | DCUMYGIJFOJLTA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|