C28H29N3O2S — CID 1141067
1-[(4-methoxyphenyl)methyl]-1-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-3-[(1S)-1-phenylethyl]thiourea (PubChem CID 1141067) has the molecular formula C28H29N3O2S and a molecular weight of 471.63 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-1-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-3-[(1S)-1-phenylethyl]thiourea.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-1-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-3-[(1S)-1-phenylethyl]thiourea |
|---|---|
| PubChem CID | 1141067 |
| Molecular Formula | C28H29N3O2S |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-1-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-3-[(1S)-1-phenylethyl]thiourea |
| SMILES | COc1ccc(CN(Cc2cc3cccc(C)c3[nH]c2=O)C(=S)N[C@@H](C)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H29N3O2S/c1-19-8-7-11-23-16-24(27(32)30-26(19)23)18-31(17-21-12-14-25(33-3)15-13-21)28(34)29-20(2)22-9-5-4-6-10-22/h4-16,20H,17-18H2,1-3H3,(H,29,34)(H,30,32)/t20-/m0/s1 |
| InChIKey | CSAZWNBKOSZQEN-FQEVSTJZSA-N |
| XLogP | 5.48 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|