C29H29N3O3S — CID 1174855
1-(1,3-benzodioxol-5-ylmethyl)-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-[(1R)-1-phenylethyl]thiourea (PubChem CID 1174855) has the molecular formula C29H29N3O3S and a molecular weight of 499.64 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-[(1R)-1-phenylethyl]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-[(1R)-1-phenylethyl]thiourea |
|---|---|
| PubChem CID | 1174855 |
| Molecular Formula | C29H29N3O3S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-[(1R)-1-phenylethyl]thiourea |
| SMILES | Cc1cc(C)c2[nH]c(=O)c(CN(Cc3ccc4c(c3)OCO4)C(=S)N[C@H](C)c3ccccc3)cc2c1 |
| InChI | InChI=1S/C29H29N3O3S/c1-18-11-19(2)27-23(12-18)14-24(28(33)31-27)16-32(15-21-9-10-25-26(13-21)35-17-34-25)29(36)30-20(3)22-7-5-4-6-8-22/h4-14,20H,15-17H2,1-3H3,(H,30,36)(H,31,33)/t20-/m1/s1 |
| InChIKey | SBZFRQVVWYVLCM-HXUWFJFHSA-N |
| XLogP | 5.51 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|