C29H29N3O5S — CID 1149946
1-(1,3-benzodioxol-5-ylmethyl)-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-[(1R)-1-phenylethyl]thiourea (PubChem CID 1149946) has the molecular formula C29H29N3O5S and a molecular weight of 531.63 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-[(1R)-1-phenylethyl]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-[(1R)-1-phenylethyl]thiourea |
|---|---|
| PubChem CID | 1149946 |
| Molecular Formula | C29H29N3O5S |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-[(1R)-1-phenylethyl]thiourea |
| SMILES | COc1cc2cc(CN(Cc3ccc4c(c3)OCO4)C(=S)N[C@H](C)c3ccccc3)c(=O)[nH]c2cc1OC |
| InChI | InChI=1S/C29H29N3O5S/c1-18(20-7-5-4-6-8-20)30-29(38)32(15-19-9-10-24-27(11-19)37-17-36-24)16-22-12-21-13-25(34-2)26(35-3)14-23(21)31-28(22)33/h4-14,18H,15-17H2,1-3H3,(H,30,38)(H,31,33)/t18-/m1/s1 |
| InChIKey | MYTJVCNSXUNDGI-GOSISDBHSA-N |
| XLogP | 4.91 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|