C26H31N3O6S — CID 3177196
1-(1,3-benzodioxol-5-ylmethyl)-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-ethoxypropyl)thiourea (PubChem CID 3177196) has the molecular formula C26H31N3O6S and a molecular weight of 513.62 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-ethoxypropyl)thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-ethoxypropyl)thiourea |
|---|---|
| PubChem CID | 3177196 |
| Molecular Formula | C26H31N3O6S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-ethoxypropyl)thiourea |
| SMILES | CCOCCCNC(=S)N(Cc1ccc2c(c1)OCO2)Cc1cc2cc(OC)c(OC)cc2[nH]c1=O |
| InChI | InChI=1S/C26H31N3O6S/c1-4-33-9-5-8-27-26(36)29(14-17-6-7-21-24(10-17)35-16-34-21)15-19-11-18-12-22(31-2)23(32-3)13-20(18)28-25(19)30/h6-7,10-13H,4-5,8-9,14-16H2,1-3H3,(H,27,36)(H,28,30) |
| InChIKey | OJPHTWHNOTYQDB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|