C25H34N4O3S2 — CID 3177207
3-[3-(diethylamino)propyl]-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 3177207) has the molecular formula C25H34N4O3S2 and a molecular weight of 502.71 g/mol. Its IUPAC name is 3-[3-(diethylamino)propyl]-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-[3-(diethylamino)propyl]-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3177207 |
| Molecular Formula | C25H34N4O3S2 |
| Molecular Weight | 502.71 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 3-[3-(diethylamino)propyl]-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | CCN(CC)CCCNC(=S)N(Cc1cccs1)Cc1cc2cc(OC)c(OC)cc2[nH]c1=O |
| InChI | InChI=1S/C25H34N4O3S2/c1-5-28(6-2)11-8-10-26-25(33)29(17-20-9-7-12-34-20)16-19-13-18-14-22(31-3)23(32-4)15-21(18)27-24(19)30/h7,9,12-15H,5-6,8,10-11,16-17H2,1-4H3,(H,26,33)(H,27,30) |
| InChIKey | VJAVGWDQYPDVAI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 69.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.71 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|