C22H27N3OS2 — CID 3174018
3-butyl-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 3174018) has the molecular formula C22H27N3OS2 and a molecular weight of 413.61 g/mol. Its IUPAC name is 3-butyl-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-butyl-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3174018 |
| Molecular Formula | C22H27N3OS2 |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 3-butyl-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | CCCCNC(=S)N(Cc1cccs1)Cc1cc2c(C)cc(C)cc2[nH]c1=O |
| InChI | InChI=1S/C22H27N3OS2/c1-4-5-8-23-22(27)25(14-18-7-6-9-28-18)13-17-12-19-16(3)10-15(2)11-20(19)24-21(17)26/h6-7,9-12H,4-5,8,13-14H2,1-3H3,(H,23,27)(H,24,26) |
| InChIKey | QXTANJVOMPJGKP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|