C26H27N3O2S2 — CID 1141557
1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 1141557) has the molecular formula C26H27N3O2S2 and a molecular weight of 477.66 g/mol. Its IUPAC name is 1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 1141557 |
| Molecular Formula | C26H27N3O2S2 |
| Molecular Weight | 477.66 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)N(Cc2cccs2)Cc2cc3c(C)cc(C)cc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C26H27N3O2S2/c1-4-31-21-9-7-20(8-10-21)27-26(32)29(16-22-6-5-11-33-22)15-19-14-23-18(3)12-17(2)13-24(23)28-25(19)30/h5-14H,4,15-16H2,1-3H3,(H,27,32)(H,28,30) |
| InChIKey | SKFMVPYNROEPSV-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.66 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|