C26H24FN3OS — CID 1133569
1-benzyl-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-fluorophenyl)thiourea (PubChem CID 1133569) has the molecular formula C26H24FN3OS and a molecular weight of 445.56 g/mol. Its IUPAC name is 1-benzyl-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-benzyl-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 1133569 |
| Molecular Formula | C26H24FN3OS |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 1-benzyl-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-fluorophenyl)thiourea |
| SMILES | Cc1cc(C)c2cc(CN(Cc3ccccc3)C(=S)Nc3ccc(F)cc3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C26H24FN3OS/c1-17-12-18(2)23-14-20(25(31)29-24(23)13-17)16-30(15-19-6-4-3-5-7-19)26(32)28-22-10-8-21(27)9-11-22/h3-14H,15-16H2,1-2H3,(H,28,32)(H,29,31) |
| InChIKey | NYPHOVGTJLAJQO-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|