C25H30N4O2S — CID 1133726
1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)-3-phenylthiourea (PubChem CID 1133726) has the molecular formula C25H30N4O2S and a molecular weight of 450.61 g/mol. Its IUPAC name is 1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)-3-phenylthiourea.
| Compound Name | 1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)-3-phenylthiourea |
|---|---|
| PubChem CID | 1133726 |
| Molecular Formula | C25H30N4O2S |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)-3-phenylthiourea |
| SMILES | Cc1cc(C)c2cc(CN(CCN3CCOCC3)C(=S)Nc3ccccc3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C25H30N4O2S/c1-18-14-19(2)22-16-20(24(30)27-23(22)15-18)17-29(9-8-28-10-12-31-13-11-28)25(32)26-21-6-4-3-5-7-21/h3-7,14-16H,8-13,17H2,1-2H3,(H,26,32)(H,27,30) |
| InChIKey | AJNBQUCFPDVUPN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|