C24H31N4OS+ — CID 6970289
2-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl-[(3-methylphenyl)carbamothioyl]amino]ethyl-dimethylazanium (PubChem CID 6970289) has the molecular formula C24H31N4OS+ and a molecular weight of 423.61 g/mol. Its IUPAC name is 2-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl-[(3-methylphenyl)carbamothioyl]amino]ethyl-dimethylazanium.
| Compound Name | 2-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl-[(3-methylphenyl)carbamothioyl]amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 6970289 |
| Molecular Formula | C24H31N4OS+ |
| Molecular Weight | 423.61 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 2-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl-[(3-methylphenyl)carbamothioyl]amino]ethyl-dimethylazanium |
| SMILES | Cc1cccc(NC(=S)N(CC[NH+](C)C)Cc2cc3c(C)cc(C)cc3[nH]c2=O)c1 |
| InChI | InChI=1S/C24H30N4OS/c1-16-7-6-8-20(12-16)25-24(30)28(10-9-27(4)5)15-19-14-21-18(3)11-17(2)13-22(21)26-23(19)29/h6-8,11-14H,9-10,15H2,1-5H3,(H,25,30)(H,26,29)/p+1 |
| InChIKey | YRZCWPBDMRXDIW-UHFFFAOYSA-O |
| XLogP | 2.80 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.61 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|