C23H37N4OS+ — CID 7108923
2-[butylcarbamothioyl-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]amino]ethyl-diethylazanium (PubChem CID 7108923) has the molecular formula C23H37N4OS+ and a molecular weight of 417.64 g/mol. Its IUPAC name is 2-[butylcarbamothioyl-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]amino]ethyl-diethylazanium.
| Compound Name | 2-[butylcarbamothioyl-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]amino]ethyl-diethylazanium |
|---|---|
| PubChem CID | 7108923 |
| Molecular Formula | C23H37N4OS+ |
| Molecular Weight | 417.64 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | 2-[butylcarbamothioyl-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]amino]ethyl-diethylazanium |
| SMILES | CCCCNC(=S)N(CC[NH+](CC)CC)Cc1cc2c(C)cc(C)cc2[nH]c1=O |
| InChI | InChI=1S/C23H36N4OS/c1-6-9-10-24-23(29)27(12-11-26(7-2)8-3)16-19-15-20-18(5)13-17(4)14-21(20)25-22(19)28/h13-15H,6-12,16H2,1-5H3,(H,24,29)(H,25,28)/p+1 |
| InChIKey | CZZVTRZDFKYPDF-UHFFFAOYSA-O |
| XLogP | 2.55 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.64 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|