C23H35N4O2S+ — CID 7108370
3-[[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl-[[(2R)-oxolan-2-yl]methyl]carbamothioyl]amino]propyl-dimethylazanium (PubChem CID 7108370) has the molecular formula C23H35N4O2S+ and a molecular weight of 431.63 g/mol. Its IUPAC name is 3-[[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl-[[(2R)-oxolan-2-yl]methyl]carbamothioyl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl-[[(2R)-oxolan-2-yl]methyl]carbamothioyl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7108370 |
| Molecular Formula | C23H35N4O2S+ |
| Molecular Weight | 431.63 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | 3-[[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl-[[(2R)-oxolan-2-yl]methyl]carbamothioyl]amino]propyl-dimethylazanium |
| SMILES | Cc1cc(C)c2cc(CN(C[C@H]3CCCO3)C(=S)NCCC[NH+](C)C)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C23H34N4O2S/c1-16-11-17(2)20-13-18(22(28)25-21(20)12-16)14-27(15-19-7-5-10-29-19)23(30)24-8-6-9-26(3)4/h11-13,19H,5-10,14-15H2,1-4H3,(H,24,30)(H,25,28)/p+1/t19-/m1/s1 |
| InChIKey | ABVQMLTWBDOZRL-LJQANCHMSA-O |
| XLogP | 1.54 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.63 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|