C28H28FN3O2S — CID 3171830
1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)-1-[(4-fluorophenyl)methyl]thiourea (PubChem CID 3171830) has the molecular formula C28H28FN3O2S and a molecular weight of 489.62 g/mol. Its IUPAC name is 1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)-1-[(4-fluorophenyl)methyl]thiourea.
| Compound Name | 1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)-1-[(4-fluorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 3171830 |
| Molecular Formula | C28H28FN3O2S |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)-1-[(4-fluorophenyl)methyl]thiourea |
| SMILES | CCOc1ccc(NC(=S)N(Cc2ccc(F)cc2)Cc2cc3c(C)ccc(C)c3[nH]c2=O)cc1 |
| InChI | InChI=1S/C28H28FN3O2S/c1-4-34-24-13-11-23(12-14-24)30-28(35)32(16-20-7-9-22(29)10-8-20)17-21-15-25-18(2)5-6-19(3)26(25)31-27(21)33/h5-15H,4,16-17H2,1-3H3,(H,30,35)(H,31,33) |
| InChIKey | DJMYFIIQDZSFCM-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|