C27H28N4O3S — CID 1137283
1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 1137283) has the molecular formula C27H28N4O3S and a molecular weight of 488.61 g/mol. Its IUPAC name is 1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 1137283 |
| Molecular Formula | C27H28N4O3S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)N(Cc2cccnc2)Cc2cc3cc(OCC)ccc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C27H28N4O3S/c1-3-33-23-9-7-22(8-10-23)29-27(35)31(17-19-6-5-13-28-16-19)18-21-14-20-15-24(34-4-2)11-12-25(20)30-26(21)32/h5-16H,3-4,17-18H2,1-2H3,(H,29,35)(H,30,32) |
| InChIKey | UOBWIFOLDIZPLS-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|