C26H24N4O4S — CID 3175616
3-(4-ethoxyphenyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 3175616) has the molecular formula C26H24N4O4S and a molecular weight of 488.57 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 3-(4-ethoxyphenyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3175616 |
| Molecular Formula | C26H24N4O4S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 3-(4-ethoxyphenyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)N(Cc2cccnc2)Cc2cc3cc4c(cc3[nH]c2=O)OCO4)cc1 |
| InChI | InChI=1S/C26H24N4O4S/c1-2-32-21-7-5-20(6-8-21)28-26(35)30(14-17-4-3-9-27-13-17)15-19-10-18-11-23-24(34-16-33-23)12-22(18)29-25(19)31/h3-13H,2,14-16H2,1H3,(H,28,35)(H,29,31) |
| InChIKey | RGQIEKXFLVROME-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|