C25H24N4OS — CID 3170301
1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-phenyl-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 3170301) has the molecular formula C25H24N4OS and a molecular weight of 428.56 g/mol. Its IUPAC name is 1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-phenyl-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-phenyl-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3170301 |
| Molecular Formula | C25H24N4OS |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-phenyl-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | CCc1ccc2[nH]c(=O)c(CN(Cc3cccnc3)C(=S)Nc3ccccc3)cc2c1 |
| InChI | InChI=1S/C25H24N4OS/c1-2-18-10-11-23-20(13-18)14-21(24(30)28-23)17-29(16-19-7-6-12-26-15-19)25(31)27-22-8-4-3-5-9-22/h3-15H,2,16-17H2,1H3,(H,27,31)(H,28,30) |
| InChIKey | KTKAVOPYFPIQLF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|