C26H26N4O2 — CID 1454936
1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-methylphenyl)-1-(pyridin-3-ylmethyl)urea (PubChem CID 1454936) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-methylphenyl)-1-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-methylphenyl)-1-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 1454936 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-methylphenyl)-1-(pyridin-3-ylmethyl)urea |
| SMILES | CCc1ccc2[nH]c(=O)c(CN(Cc3cccnc3)C(=O)Nc3ccc(C)cc3)cc2c1 |
| InChI | InChI=1S/C26H26N4O2/c1-3-19-8-11-24-21(13-19)14-22(25(31)29-24)17-30(16-20-5-4-12-27-15-20)26(32)28-23-9-6-18(2)7-10-23/h4-15H,3,16-17H2,1-2H3,(H,28,32)(H,29,31) |
| InChIKey | FMXUOXJXPQFFBI-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |