C26H26N4OS — CID 3174128
3-(2,4-dimethylphenyl)-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 3174128) has the molecular formula C26H26N4OS and a molecular weight of 442.59 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 3-(2,4-dimethylphenyl)-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3174128 |
| Molecular Formula | C26H26N4OS |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | Cc1ccc(NC(=S)N(Cc2cccnc2)Cc2cc3ccc(C)cc3[nH]c2=O)c(C)c1 |
| InChI | InChI=1S/C26H26N4OS/c1-17-7-9-23(19(3)11-17)29-26(32)30(15-20-5-4-10-27-14-20)16-22-13-21-8-6-18(2)12-24(21)28-25(22)31/h4-14H,15-16H2,1-3H3,(H,28,31)(H,29,32) |
| InChIKey | OVSJOYJOWLNSHO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|