C27H24FN3O3S — CID 1134184
1-(1,3-benzodioxol-5-ylmethyl)-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-fluorophenyl)thiourea (PubChem CID 1134184) has the molecular formula C27H24FN3O3S and a molecular weight of 489.57 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 1134184 |
| Molecular Formula | C27H24FN3O3S |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-fluorophenyl)thiourea |
| SMILES | CCc1ccc2[nH]c(=O)c(CN(Cc3ccc4c(c3)OCO4)C(=S)Nc3ccc(F)cc3)cc2c1 |
| InChI | InChI=1S/C27H24FN3O3S/c1-2-17-3-9-23-19(11-17)13-20(26(32)30-23)15-31(27(35)29-22-7-5-21(28)6-8-22)14-18-4-10-24-25(12-18)34-16-33-24/h3-13H,2,14-16H2,1H3,(H,29,35)(H,30,32) |
| InChIKey | FLXQRSYCONHJRN-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|