C29H29N3O4S — CID 3176003
3-(4-ethoxyphenyl)-1-[2-(3-methylphenyl)ethyl]-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]thiourea (PubChem CID 3176003) has the molecular formula C29H29N3O4S and a molecular weight of 515.64 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-1-[2-(3-methylphenyl)ethyl]-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]thiourea.
| Compound Name | 3-(4-ethoxyphenyl)-1-[2-(3-methylphenyl)ethyl]-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]thiourea |
|---|---|
| PubChem CID | 3176003 |
| Molecular Formula | C29H29N3O4S |
| Molecular Weight | 515.64 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | 3-(4-ethoxyphenyl)-1-[2-(3-methylphenyl)ethyl]-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]thiourea |
| SMILES | CCOc1ccc(NC(=S)N(CCc2cccc(C)c2)Cc2cc3cc4c(cc3[nH]c2=O)OCO4)cc1 |
| InChI | InChI=1S/C29H29N3O4S/c1-3-34-24-9-7-23(8-10-24)30-29(37)32(12-11-20-6-4-5-19(2)13-20)17-22-14-21-15-26-27(36-18-35-26)16-25(21)31-28(22)33/h4-10,13-16H,3,11-12,17-18H2,1-2H3,(H,30,37)(H,31,33) |
| InChIKey | NBQYJQLXABWMPO-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.64 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|