C28H29N3O3S — CID 1150008
1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[2-(3-methylphenyl)ethyl]-3-phenylthiourea (PubChem CID 1150008) has the molecular formula C28H29N3O3S and a molecular weight of 487.63 g/mol. Its IUPAC name is 1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[2-(3-methylphenyl)ethyl]-3-phenylthiourea.
| Compound Name | 1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[2-(3-methylphenyl)ethyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 1150008 |
| Molecular Formula | C28H29N3O3S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[2-(3-methylphenyl)ethyl]-3-phenylthiourea |
| SMILES | COc1cc2cc(CN(CCc3cccc(C)c3)C(=S)Nc3ccccc3)c(=O)[nH]c2cc1OC |
| InChI | InChI=1S/C28H29N3O3S/c1-19-8-7-9-20(14-19)12-13-31(28(35)29-23-10-5-4-6-11-23)18-22-15-21-16-25(33-2)26(34-3)17-24(21)30-27(22)32/h4-11,14-17H,12-13,18H2,1-3H3,(H,29,35)(H,30,32) |
| InChIKey | YFDNEKWFLGHUKM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|