C24H29ClN4O3S — CID 3177259
3-(3-chlorophenyl)-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[3-(dimethylamino)propyl]thiourea (PubChem CID 3177259) has the molecular formula C24H29ClN4O3S and a molecular weight of 489.04 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[3-(dimethylamino)propyl]thiourea.
| Compound Name | 3-(3-chlorophenyl)-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[3-(dimethylamino)propyl]thiourea |
|---|---|
| PubChem CID | 3177259 |
| Molecular Formula | C24H29ClN4O3S |
| Molecular Weight | 489.04 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[3-(dimethylamino)propyl]thiourea |
| SMILES | COc1cc2cc(CN(CCCN(C)C)C(=S)Nc3cccc(Cl)c3)c(=O)[nH]c2cc1OC |
| InChI | InChI=1S/C24H29ClN4O3S/c1-28(2)9-6-10-29(24(33)26-19-8-5-7-18(25)13-19)15-17-11-16-12-21(31-3)22(32-4)14-20(16)27-23(17)30/h5,7-8,11-14H,6,9-10,15H2,1-4H3,(H,26,33)(H,27,30) |
| InChIKey | HEZWVKSWRBWOEE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 69.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.04 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|