C30H33N3O3S — CID 1150023
1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-ethylphenyl)-1-[2-(3-methylphenyl)ethyl]thiourea (PubChem CID 1150023) has the molecular formula C30H33N3O3S and a molecular weight of 515.68 g/mol. Its IUPAC name is 1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-ethylphenyl)-1-[2-(3-methylphenyl)ethyl]thiourea.
| Compound Name | 1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-ethylphenyl)-1-[2-(3-methylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 1150023 |
| Molecular Formula | C30H33N3O3S |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-ethylphenyl)-1-[2-(3-methylphenyl)ethyl]thiourea |
| SMILES | CCc1ccccc1NC(=S)N(CCc1cccc(C)c1)Cc1cc2cc(OC)c(OC)cc2[nH]c1=O |
| InChI | InChI=1S/C30H33N3O3S/c1-5-22-11-6-7-12-25(22)32-30(37)33(14-13-21-10-8-9-20(2)15-21)19-24-16-23-17-27(35-3)28(36-4)18-26(23)31-29(24)34/h6-12,15-18H,5,13-14,19H2,1-4H3,(H,31,34)(H,32,37) |
| InChIKey | BLFFUXBCRATFBG-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|