C20H23N3OS2 — CID 3173997
1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-ethyl-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 3173997) has the molecular formula C20H23N3OS2 and a molecular weight of 385.56 g/mol. Its IUPAC name is 1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-ethyl-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-ethyl-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3173997 |
| Molecular Formula | C20H23N3OS2 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-ethyl-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | CCNC(=S)N(Cc1cccs1)Cc1cc2cc(C)cc(C)c2[nH]c1=O |
| InChI | InChI=1S/C20H23N3OS2/c1-4-21-20(25)23(12-17-6-5-7-26-17)11-16-10-15-9-13(2)8-14(3)18(15)22-19(16)24/h5-10H,4,11-12H2,1-3H3,(H,21,25)(H,22,24) |
| InChIKey | JGUMGPHGLJNBRO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|