C25H34N4O2S — CID 3171420
3-[3-(diethylamino)propyl]-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(furan-2-ylmethyl)thiourea (PubChem CID 3171420) has the molecular formula C25H34N4O2S and a molecular weight of 454.64 g/mol. Its IUPAC name is 3-[3-(diethylamino)propyl]-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(furan-2-ylmethyl)thiourea.
| Compound Name | 3-[3-(diethylamino)propyl]-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3171420 |
| Molecular Formula | C25H34N4O2S |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 3-[3-(diethylamino)propyl]-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(furan-2-ylmethyl)thiourea |
| SMILES | CCN(CC)CCCNC(=S)N(Cc1ccco1)Cc1cc2cc(C)cc(C)c2[nH]c1=O |
| InChI | InChI=1S/C25H34N4O2S/c1-5-28(6-2)11-8-10-26-25(32)29(17-22-9-7-12-31-22)16-21-15-20-14-18(3)13-19(4)23(20)27-24(21)30/h7,9,12-15H,5-6,8,10-11,16-17H2,1-4H3,(H,26,32)(H,27,30) |
| InChIKey | YIOPGJBUAGKZRD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|