C23H30N4O2S — CID 3170299
3-[3-(dimethylamino)propyl]-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(furan-2-ylmethyl)thiourea (PubChem CID 3170299) has the molecular formula C23H30N4O2S and a molecular weight of 426.59 g/mol. Its IUPAC name is 3-[3-(dimethylamino)propyl]-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(furan-2-ylmethyl)thiourea.
| Compound Name | 3-[3-(dimethylamino)propyl]-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3170299 |
| Molecular Formula | C23H30N4O2S |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 3-[3-(dimethylamino)propyl]-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(furan-2-ylmethyl)thiourea |
| SMILES | CCc1ccc2[nH]c(=O)c(CN(Cc3ccco3)C(=S)NCCCN(C)C)cc2c1 |
| InChI | InChI=1S/C23H30N4O2S/c1-4-17-8-9-21-18(13-17)14-19(22(28)25-21)15-27(16-20-7-5-12-29-20)23(30)24-10-6-11-26(2)3/h5,7-9,12-14H,4,6,10-11,15-16H2,1-3H3,(H,24,30)(H,25,28) |
| InChIKey | DXIFKLNJGQLLRJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|