C23H30N4O3S — CID 3184512
1-[3-(dimethylamino)propyl]-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(furan-2-ylmethyl)thiourea (PubChem CID 3184512) has the molecular formula C23H30N4O3S and a molecular weight of 442.59 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-[3-(dimethylamino)propyl]-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3184512 |
| Molecular Formula | C23H30N4O3S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(furan-2-ylmethyl)thiourea |
| SMILES | CCOc1ccc2[nH]c(=O)c(CN(CCCN(C)C)C(=S)NCc3ccco3)cc2c1 |
| InChI | InChI=1S/C23H30N4O3S/c1-4-29-19-8-9-21-17(14-19)13-18(22(28)25-21)16-27(11-6-10-26(2)3)23(31)24-15-20-7-5-12-30-20/h5,7-9,12-14H,4,6,10-11,15-16H2,1-3H3,(H,24,31)(H,25,28) |
| InChIKey | NOZVVCZGKZTMHV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|