C26H27N3O3S — CID 1140350
1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(furan-2-ylmethyl)-3-[(1S)-1-phenylethyl]thiourea (PubChem CID 1140350) has the molecular formula C26H27N3O3S and a molecular weight of 461.59 g/mol. Its IUPAC name is 1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(furan-2-ylmethyl)-3-[(1S)-1-phenylethyl]thiourea.
| Compound Name | 1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(furan-2-ylmethyl)-3-[(1S)-1-phenylethyl]thiourea |
|---|---|
| PubChem CID | 1140350 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(furan-2-ylmethyl)-3-[(1S)-1-phenylethyl]thiourea |
| SMILES | CCOc1ccc2[nH]c(=O)c(CN(Cc3ccco3)C(=S)N[C@@H](C)c3ccccc3)cc2c1 |
| InChI | InChI=1S/C26H27N3O3S/c1-3-31-22-11-12-24-20(15-22)14-21(25(30)28-24)16-29(17-23-10-7-13-32-23)26(33)27-18(2)19-8-5-4-6-9-19/h4-15,18H,3,16-17H2,1-2H3,(H,27,33)(H,28,30)/t18-/m0/s1 |
| InChIKey | ARAIBYFTMLLZDJ-SFHVURJKSA-N |
| XLogP | 5.16 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|