C22H25N3O3S — CID 3172273
1-(2-hydroxyethyl)-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(1-phenylethyl)thiourea (PubChem CID 3172273) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(1-phenylethyl)thiourea.
| Compound Name | 1-(2-hydroxyethyl)-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(1-phenylethyl)thiourea |
|---|---|
| PubChem CID | 3172273 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 1-(2-hydroxyethyl)-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(1-phenylethyl)thiourea |
| SMILES | COc1ccc2[nH]c(=O)c(CN(CCO)C(=S)NC(C)c3ccccc3)cc2c1 |
| InChI | InChI=1S/C22H25N3O3S/c1-15(16-6-4-3-5-7-16)23-22(29)25(10-11-26)14-18-12-17-13-19(28-2)8-9-20(17)24-21(18)27/h3-9,12-13,15,26H,10-11,14H2,1-2H3,(H,23,29)(H,24,27) |
| InChIKey | JONFQSKXTGLXBQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|