C22H26N4O2S — CID 1138312
1-[2-(dimethylamino)ethyl]-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-phenylthiourea (PubChem CID 1138312) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-phenylthiourea.
| Compound Name | 1-[2-(dimethylamino)ethyl]-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 1138312 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-phenylthiourea |
| SMILES | COc1ccc2[nH]c(=O)c(CN(CCN(C)C)C(=S)Nc3ccccc3)cc2c1 |
| InChI | InChI=1S/C22H26N4O2S/c1-25(2)11-12-26(22(29)23-18-7-5-4-6-8-18)15-17-13-16-14-19(28-3)9-10-20(16)24-21(17)27/h4-10,13-14H,11-12,15H2,1-3H3,(H,23,29)(H,24,27) |
| InChIKey | HTVYVCIGXBXPOF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|