C28H29N3O3S — CID 1141326
1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]-3-[(1R)-1-phenylethyl]thiourea (PubChem CID 1141326) has the molecular formula C28H29N3O3S and a molecular weight of 487.63 g/mol. Its IUPAC name is 1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]-3-[(1R)-1-phenylethyl]thiourea.
| Compound Name | 1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]-3-[(1R)-1-phenylethyl]thiourea |
|---|---|
| PubChem CID | 1141326 |
| Molecular Formula | C28H29N3O3S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]-3-[(1R)-1-phenylethyl]thiourea |
| SMILES | COc1ccc(CN(Cc2cc3ccc(OC)cc3[nH]c2=O)C(=S)N[C@H](C)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H29N3O3S/c1-19(21-7-5-4-6-8-21)29-28(35)31(17-20-9-12-24(33-2)13-10-20)18-23-15-22-11-14-25(34-3)16-26(22)30-27(23)32/h4-16,19H,17-18H2,1-3H3,(H,29,35)(H,30,32)/t19-/m1/s1 |
| InChIKey | PJWZNJCKSVMZCK-LJQANCHMSA-N |
| XLogP | 5.18 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|