C25H31N3O2S — CID 3176951
1-benzyl-3-(3-ethoxypropyl)-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea (PubChem CID 3176951) has the molecular formula C25H31N3O2S and a molecular weight of 437.61 g/mol. Its IUPAC name is 1-benzyl-3-(3-ethoxypropyl)-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea.
| Compound Name | 1-benzyl-3-(3-ethoxypropyl)-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 3176951 |
| Molecular Formula | C25H31N3O2S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 1-benzyl-3-(3-ethoxypropyl)-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
| SMILES | CCOCCCNC(=S)N(Cc1ccccc1)Cc1cc2cc(CC)ccc2[nH]c1=O |
| InChI | InChI=1S/C25H31N3O2S/c1-3-19-11-12-23-21(15-19)16-22(24(29)27-23)18-28(17-20-9-6-5-7-10-20)25(31)26-13-8-14-30-4-2/h5-7,9-12,15-16H,3-4,8,13-14,17-18H2,1-2H3,(H,26,31)(H,27,29) |
| InChIKey | NEALGIPSJJKBEV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|