C22H25N3O2S — CID 3173861
1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]-3-methylthiourea (PubChem CID 3173861) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is 1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]-3-methylthiourea.
| Compound Name | 1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]-3-methylthiourea |
|---|---|
| PubChem CID | 3173861 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]-3-methylthiourea |
| SMILES | CCc1ccc2[nH]c(=O)c(CN(Cc3ccc(OC)cc3)C(=S)NC)cc2c1 |
| InChI | InChI=1S/C22H25N3O2S/c1-4-15-7-10-20-17(11-15)12-18(21(26)24-20)14-25(22(28)23-2)13-16-5-8-19(27-3)9-6-16/h5-12H,4,13-14H2,1-3H3,(H,23,28)(H,24,26) |
| InChIKey | BTMYORKVTPASDU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|