C25H31N3O3S — CID 3173942
3-butyl-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]thiourea (PubChem CID 3173942) has the molecular formula C25H31N3O3S and a molecular weight of 453.61 g/mol. Its IUPAC name is 3-butyl-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]thiourea.
| Compound Name | 3-butyl-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 3173942 |
| Molecular Formula | C25H31N3O3S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 3-butyl-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]thiourea |
| SMILES | CCCCNC(=S)N(Cc1ccc(OC)cc1)Cc1cc2cc(OCC)ccc2[nH]c1=O |
| InChI | InChI=1S/C25H31N3O3S/c1-4-6-13-26-25(32)28(16-18-7-9-21(30-3)10-8-18)17-20-14-19-15-22(31-5-2)11-12-23(19)27-24(20)29/h7-12,14-15H,4-6,13,16-17H2,1-3H3,(H,26,32)(H,27,29) |
| InChIKey | XJONALBUNVIENY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|