C22H34N4O2S — CID 3172643
1-[2-(diethylamino)ethyl]-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methoxyethyl)thiourea (PubChem CID 3172643) has the molecular formula C22H34N4O2S and a molecular weight of 418.61 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-[2-(diethylamino)ethyl]-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 3172643 |
| Molecular Formula | C22H34N4O2S |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methoxyethyl)thiourea |
| SMILES | CCc1ccc2[nH]c(=O)c(CN(CCN(CC)CC)C(=S)NCCOC)cc2c1 |
| InChI | InChI=1S/C22H34N4O2S/c1-5-17-8-9-20-18(14-17)15-19(21(27)24-20)16-26(12-11-25(6-2)7-3)22(29)23-10-13-28-4/h8-9,14-15H,5-7,10-13,16H2,1-4H3,(H,23,29)(H,24,27) |
| InChIKey | JEKNQFVYBVIANP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|